C28H35N3O2 — CID 110578980
3-(2,4-dimethylphenyl)-1-hexyl-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110578980) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-1-hexyl-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dimethylphenyl)-1-hexyl-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110578980 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-1-hexyl-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | CCCCCCN1C(=O)C(c2ccc(C)cc2C)=C(N2CCN(c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C28H35N3O2/c1-4-5-6-10-15-31-27(32)25(24-14-13-21(2)20-22(24)3)26(28(31)33)30-18-16-29(17-19-30)23-11-8-7-9-12-23/h7-9,11-14,20H,4-6,10,15-19H2,1-3H3 |
| InChIKey | YIWUIHBCIVIRSL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|