C29H36N2O2 — CID 110560027
1-decyl-3-(3,4-dihydro-2H-quinolin-1-yl)-4-phenylpyrrole-2,5-dione (PubChem CID 110560027) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is 1-decyl-3-(3,4-dihydro-2H-quinolin-1-yl)-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-decyl-3-(3,4-dihydro-2H-quinolin-1-yl)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110560027 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 1-decyl-3-(3,4-dihydro-2H-quinolin-1-yl)-4-phenylpyrrole-2,5-dione |
| SMILES | CCCCCCCCCCN1C(=O)C(c2ccccc2)=C(N2CCCc3ccccc32)C1=O |
| InChI | InChI=1S/C29H36N2O2/c1-2-3-4-5-6-7-8-14-21-31-28(32)26(24-17-10-9-11-18-24)27(29(31)33)30-22-15-19-23-16-12-13-20-25(23)30/h9-13,16-18,20H,2-8,14-15,19,21-22H2,1H3 |
| InChIKey | PGOFOIYWCIHGNV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|