C22H20Cl2N2O2 — CID 110568157
3-(2,4-dichlorophenyl)-4-(3,4-dihydro-2H-quinolin-1-yl)-1-propylpyrrole-2,5-dione (PubChem CID 110568157) has the molecular formula C22H20Cl2N2O2 and a molecular weight of 415.32 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-(3,4-dihydro-2H-quinolin-1-yl)-1-propylpyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-4-(3,4-dihydro-2H-quinolin-1-yl)-1-propylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568157 |
| Molecular Formula | C22H20Cl2N2O2 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-(3,4-dihydro-2H-quinolin-1-yl)-1-propylpyrrole-2,5-dione |
| SMILES | CCCN1C(=O)C(c2ccc(Cl)cc2Cl)=C(N2CCCc3ccccc32)C1=O |
| InChI | InChI=1S/C22H20Cl2N2O2/c1-2-11-26-21(27)19(16-10-9-15(23)13-17(16)24)20(22(26)28)25-12-5-7-14-6-3-4-8-18(14)25/h3-4,6,8-10,13H,2,5,7,11-12H2,1H3 |
| InChIKey | AMIYBEDWKFMFKA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|