C16H16Cl2N2O2 — CID 110568175
3-(2,4-dichlorophenyl)-1-ethyl-4-pyrrolidin-1-ylpyrrole-2,5-dione (PubChem CID 110568175) has the molecular formula C16H16Cl2N2O2 and a molecular weight of 339.22 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-ethyl-4-pyrrolidin-1-ylpyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-1-ethyl-4-pyrrolidin-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568175 |
| Molecular Formula | C16H16Cl2N2O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-ethyl-4-pyrrolidin-1-ylpyrrole-2,5-dione |
| SMILES | CCN1C(=O)C(c2ccc(Cl)cc2Cl)=C(N2CCCC2)C1=O |
| InChI | InChI=1S/C16H16Cl2N2O2/c1-2-20-15(21)13(11-6-5-10(17)9-12(11)18)14(16(20)22)19-7-3-4-8-19/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | RWDHEPKVUOSKTG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|