C21H17Cl2FN2O2 — CID 110568680
3-(2,4-dichlorophenyl)-1-(2-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione (PubChem CID 110568680) has the molecular formula C21H17Cl2FN2O2 and a molecular weight of 419.28 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-(2-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-1-(2-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568680 |
| Molecular Formula | C21H17Cl2FN2O2 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-(2-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc(Cl)cc2Cl)=C(N2CCCCC2)C(=O)N1c1ccccc1F |
| InChI | InChI=1S/C21H17Cl2FN2O2/c22-13-8-9-14(15(23)12-13)18-19(25-10-4-1-5-11-25)21(28)26(20(18)27)17-7-3-2-6-16(17)24/h2-3,6-9,12H,1,4-5,10-11H2 |
| InChIKey | NEVSTHANFNEJRG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|