C25H18Cl2N2O2 — CID 110568787
3-(2,4-dichlorophenyl)-4-(3,4-dihydro-1H-isoquinolin-2-yl)-1-phenylpyrrole-2,5-dione (PubChem CID 110568787) has the molecular formula C25H18Cl2N2O2 and a molecular weight of 449.34 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-(3,4-dihydro-1H-isoquinolin-2-yl)-1-phenylpyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-4-(3,4-dihydro-1H-isoquinolin-2-yl)-1-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568787 |
| Molecular Formula | C25H18Cl2N2O2 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-(3,4-dihydro-1H-isoquinolin-2-yl)-1-phenylpyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc(Cl)cc2Cl)=C(N2CCc3ccccc3C2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C25H18Cl2N2O2/c26-18-10-11-20(21(27)14-18)22-23(28-13-12-16-6-4-5-7-17(16)15-28)25(31)29(24(22)30)19-8-2-1-3-9-19/h1-11,14H,12-13,15H2 |
| InChIKey | RASMFAGMMWTILS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|