C21H19Cl2N3O2 — CID 110568220
3-(2,4-dichlorophenyl)-1-methyl-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110568220) has the molecular formula C21H19Cl2N3O2 and a molecular weight of 416.31 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-methyl-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-1-methyl-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568220 |
| Molecular Formula | C21H19Cl2N3O2 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-methyl-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | CN1C(=O)C(c2ccc(Cl)cc2Cl)=C(N2CCN(c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C21H19Cl2N3O2/c1-24-20(27)18(16-8-7-14(22)13-17(16)23)19(21(24)28)26-11-9-25(10-12-26)15-5-3-2-4-6-15/h2-8,13H,9-12H2,1H3 |
| InChIKey | XWBLQZIKGNEAPN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|