C19H17Cl2N5O2 — CID 110568224
3-(2,4-dichlorophenyl)-1-methyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110568224) has the molecular formula C19H17Cl2N5O2 and a molecular weight of 418.28 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-methyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-1-methyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568224 |
| Molecular Formula | C19H17Cl2N5O2 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-methyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | CN1C(=O)C(c2ccc(Cl)cc2Cl)=C(N2CCN(c3ncccn3)CC2)C1=O |
| InChI | InChI=1S/C19H17Cl2N5O2/c1-24-17(27)15(13-4-3-12(20)11-14(13)21)16(18(24)28)25-7-9-26(10-8-25)19-22-5-2-6-23-19/h2-6,11H,7-10H2,1H3 |
| InChIKey | JCPAEKMGRWPVCC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|