C16H8Cl3NO3 — CID 110581807
1-(2-chlorophenyl)-3-(2,4-dichlorophenyl)-4-hydroxypyrrole-2,5-dione (PubChem CID 110581807) has the molecular formula C16H8Cl3NO3 and a molecular weight of 368.60 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(2,4-dichlorophenyl)-4-hydroxypyrrole-2,5-dione.
| Compound Name | 1-(2-chlorophenyl)-3-(2,4-dichlorophenyl)-4-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 110581807 |
| Molecular Formula | C16H8Cl3NO3 |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(2,4-dichlorophenyl)-4-hydroxypyrrole-2,5-dione |
| SMILES | O=C1C(O)=C(c2ccc(Cl)cc2Cl)C(=O)N1c1ccccc1Cl |
| InChI | InChI=1S/C16H8Cl3NO3/c17-8-5-6-9(11(19)7-8)13-14(21)16(23)20(15(13)22)12-4-2-1-3-10(12)18/h1-7,21H |
| InChIKey | OUHCRIVVVYNFNO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|