C18H14ClNO3 — CID 110582015
1-(3-chloro-2-methylphenyl)-3-hydroxy-4-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110582015) has the molecular formula C18H14ClNO3 and a molecular weight of 327.77 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-hydroxy-4-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-hydroxy-4-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110582015 |
| Molecular Formula | C18H14ClNO3 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-hydroxy-4-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(O)C(=O)N(c3cccc(Cl)c3C)C2=O)cc1 |
| InChI | InChI=1S/C18H14ClNO3/c1-10-6-8-12(9-7-10)15-16(21)18(23)20(17(15)22)14-5-3-4-13(19)11(14)2/h3-9,21H,1-2H3 |
| InChIKey | KMIJFVZCEUWXJR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|