C19H14Cl2N2O3 — CID 110583591
N-[4-[4-chloro-1-(3-chloro-2-methylphenyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide (PubChem CID 110583591) has the molecular formula C19H14Cl2N2O3 and a molecular weight of 389.24 g/mol. Its IUPAC name is N-[4-[4-chloro-1-(3-chloro-2-methylphenyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-chloro-1-(3-chloro-2-methylphenyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110583591 |
| Molecular Formula | C19H14Cl2N2O3 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | N-[4-[4-chloro-1-(3-chloro-2-methylphenyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=C(Cl)C(=O)N(c3cccc(Cl)c3C)C2=O)cc1 |
| InChI | InChI=1S/C19H14Cl2N2O3/c1-10-14(20)4-3-5-15(10)23-18(25)16(17(21)19(23)26)12-6-8-13(9-7-12)22-11(2)24/h3-9H,1-2H3,(H,22,24) |
| InChIKey | OUKOKQGDSOWDIV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|