C18H11Cl3N2O3 — CID 110583595
N-[4-[4-chloro-1-(3,5-dichlorophenyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide (PubChem CID 110583595) has the molecular formula C18H11Cl3N2O3 and a molecular weight of 409.66 g/mol. Its IUPAC name is N-[4-[4-chloro-1-(3,5-dichlorophenyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-chloro-1-(3,5-dichlorophenyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110583595 |
| Molecular Formula | C18H11Cl3N2O3 |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | N-[4-[4-chloro-1-(3,5-dichlorophenyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=C(Cl)C(=O)N(c3cc(Cl)cc(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C18H11Cl3N2O3/c1-9(24)22-13-4-2-10(3-5-13)15-16(21)18(26)23(17(15)25)14-7-11(19)6-12(20)8-14/h2-8H,1H3,(H,22,24) |
| InChIKey | KJDNSTAWSULXLS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|