C24H17ClN2O3S — CID 110570969
N-[4-[3-(4-chlorophenyl)-2,5-dioxo-4-phenylsulfanylpyrrol-1-yl]phenyl]acetamide (PubChem CID 110570969) has the molecular formula C24H17ClN2O3S and a molecular weight of 448.93 g/mol. Its IUPAC name is N-[4-[3-(4-chlorophenyl)-2,5-dioxo-4-phenylsulfanylpyrrol-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-(4-chlorophenyl)-2,5-dioxo-4-phenylsulfanylpyrrol-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110570969 |
| Molecular Formula | C24H17ClN2O3S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | N-[4-[3-(4-chlorophenyl)-2,5-dioxo-4-phenylsulfanylpyrrol-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C(Sc3ccccc3)=C(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H17ClN2O3S/c1-15(28)26-18-11-13-19(14-12-18)27-23(29)21(16-7-9-17(25)10-8-16)22(24(27)30)31-20-5-3-2-4-6-20/h2-14H,1H3,(H,26,28) |
| InChIKey | ZFJSWOGJWSNPET-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|