C24H18N2O3S — CID 110561337
N-[4-(2,5-dioxo-3-phenyl-4-phenylsulfanylpyrrol-1-yl)phenyl]acetamide (PubChem CID 110561337) has the molecular formula C24H18N2O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is N-[4-(2,5-dioxo-3-phenyl-4-phenylsulfanylpyrrol-1-yl)phenyl]acetamide.
| Compound Name | N-[4-(2,5-dioxo-3-phenyl-4-phenylsulfanylpyrrol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 110561337 |
| Molecular Formula | C24H18N2O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-[4-(2,5-dioxo-3-phenyl-4-phenylsulfanylpyrrol-1-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C(Sc3ccccc3)=C(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H18N2O3S/c1-16(27)25-18-12-14-19(15-13-18)26-23(28)21(17-8-4-2-5-9-17)22(24(26)29)30-20-10-6-3-7-11-20/h2-15H,1H3,(H,25,27) |
| InChIKey | DZWVHEHFORLCRR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|