C19H16ClNO3 — CID 110582709
1-(4-chloro-2-methylphenyl)-3-(2,4-dimethylphenyl)-4-hydroxypyrrole-2,5-dione (PubChem CID 110582709) has the molecular formula C19H16ClNO3 and a molecular weight of 341.79 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-3-(2,4-dimethylphenyl)-4-hydroxypyrrole-2,5-dione.
| Compound Name | 1-(4-chloro-2-methylphenyl)-3-(2,4-dimethylphenyl)-4-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 110582709 |
| Molecular Formula | C19H16ClNO3 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-3-(2,4-dimethylphenyl)-4-hydroxypyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(O)C(=O)N(c3ccc(Cl)cc3C)C2=O)c(C)c1 |
| InChI | InChI=1S/C19H16ClNO3/c1-10-4-6-14(11(2)8-10)16-17(22)19(24)21(18(16)23)15-7-5-13(20)9-12(15)3/h4-9,22H,1-3H3 |
| InChIKey | QJDIYQCTAZQURD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|