C12H9Cl2NO2 — CID 709008
3,4-dichloro-1-(2,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 709008) has the molecular formula C12H9Cl2NO2 and a molecular weight of 270.12 g/mol. Its IUPAC name is 3,4-dichloro-1-(2,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 3,4-dichloro-1-(2,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 709008 |
| Molecular Formula | C12H9Cl2NO2 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 3,4-dichloro-1-(2,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(Cl)=C(Cl)C2=O)c(C)c1 |
| InChI | InChI=1S/C12H9Cl2NO2/c1-6-3-4-8(7(2)5-6)15-11(16)9(13)10(14)12(15)17/h3-5H,1-2H3 |
| InChIKey | IYKULAKDXHIXJH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|