C27H23ClN2O2 — CID 110578146
1-[(2-chlorophenyl)methyl]-3-(2,3-dihydroindol-1-yl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110578146) has the molecular formula C27H23ClN2O2 and a molecular weight of 442.95 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-(2,3-dihydroindol-1-yl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-(2,3-dihydroindol-1-yl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110578146 |
| Molecular Formula | C27H23ClN2O2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-(2,3-dihydroindol-1-yl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CCc4ccccc43)C(=O)N(Cc3ccccc3Cl)C2=O)c(C)c1 |
| InChI | InChI=1S/C27H23ClN2O2/c1-17-11-12-21(18(2)15-17)24-25(29-14-13-19-7-4-6-10-23(19)29)27(32)30(26(24)31)16-20-8-3-5-9-22(20)28/h3-12,15H,13-14,16H2,1-2H3 |
| InChIKey | MDODKAFVFQKYOY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|