C28H26N2O2 — CID 110579587
3-(2,3-dihydroindol-1-yl)-4-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110579587) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)-4-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,3-dihydroindol-1-yl)-4-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110579587 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)-4-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CCc4ccccc43)C(=O)N(c3ccc(C)c(C)c3)C2=O)c(C)c1 |
| InChI | InChI=1S/C28H26N2O2/c1-17-9-12-23(20(4)15-17)25-26(29-14-13-21-7-5-6-8-24(21)29)28(32)30(27(25)31)22-11-10-18(2)19(3)16-22/h5-12,15-16H,13-14H2,1-4H3 |
| InChIKey | KLLHUODVLZUQKD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|