C28H26N2O4 — CID 110579610
3-(2,3-dihydroindol-1-yl)-1-(2,5-dimethoxyphenyl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110579610) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)-1-(2,5-dimethoxyphenyl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,3-dihydroindol-1-yl)-1-(2,5-dimethoxyphenyl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110579610 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)-1-(2,5-dimethoxyphenyl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(OC)c(N2C(=O)C(c3ccc(C)cc3C)=C(N3CCc4ccccc43)C2=O)c1 |
| InChI | InChI=1S/C28H26N2O4/c1-17-9-11-21(18(2)15-17)25-26(29-14-13-19-7-5-6-8-22(19)29)28(32)30(27(25)31)23-16-20(33-3)10-12-24(23)34-4/h5-12,15-16H,13-14H2,1-4H3 |
| InChIKey | INWQCKBCRZTUPN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|