C28H24N2O4 — CID 110578197
1-(1,3-benzodioxol-5-ylmethyl)-3-(2,3-dihydroindol-1-yl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110578197) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(2,3-dihydroindol-1-yl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(2,3-dihydroindol-1-yl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110578197 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(2,3-dihydroindol-1-yl)-4-(2,4-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CCc4ccccc43)C(=O)N(Cc3ccc4c(c3)OCO4)C2=O)c(C)c1 |
| InChI | InChI=1S/C28H24N2O4/c1-17-7-9-21(18(2)13-17)25-26(29-12-11-20-5-3-4-6-22(20)29)28(32)30(27(25)31)15-19-8-10-23-24(14-19)34-16-33-23/h3-10,13-14H,11-12,15-16H2,1-2H3 |
| InChIKey | PIBVVFUGLQCBGO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|