C17H19Cl2NO4S — CID 110568563
3-(2,4-dichlorophenyl)-1-(3-ethoxypropyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione (PubChem CID 110568563) has the molecular formula C17H19Cl2NO4S and a molecular weight of 404.32 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-(3-ethoxypropyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-1-(3-ethoxypropyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568563 |
| Molecular Formula | C17H19Cl2NO4S |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-(3-ethoxypropyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
| SMILES | CCOCCCN1C(=O)C(SCCO)=C(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C17H19Cl2NO4S/c1-2-24-8-3-6-20-16(22)14(15(17(20)23)25-9-7-21)12-5-4-11(18)10-13(12)19/h4-5,10,21H,2-3,6-9H2,1H3 |
| InChIKey | VKKJRVAXMZUHCS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|