C20H17Cl2NO3S — CID 110568658
3-(2,4-dichlorophenyl)-1-(3,5-dimethylphenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione (PubChem CID 110568658) has the molecular formula C20H17Cl2NO3S and a molecular weight of 422.33 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-(3,5-dimethylphenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-1-(3,5-dimethylphenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568658 |
| Molecular Formula | C20H17Cl2NO3S |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-(3,5-dimethylphenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
| SMILES | Cc1cc(C)cc(N2C(=O)C(SCCO)=C(c3ccc(Cl)cc3Cl)C2=O)c1 |
| InChI | InChI=1S/C20H17Cl2NO3S/c1-11-7-12(2)9-14(8-11)23-19(25)17(18(20(23)26)27-6-5-24)15-4-3-13(21)10-16(15)22/h3-4,7-10,24H,5-6H2,1-2H3 |
| InChIKey | RPVUHQXBGRBLDJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|