C19H16ClNO3S — CID 110570938
3-(4-chlorophenyl)-4-(2-hydroxyethylsulfanyl)-1-(3-methylphenyl)pyrrole-2,5-dione (PubChem CID 110570938) has the molecular formula C19H16ClNO3S and a molecular weight of 373.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(2-hydroxyethylsulfanyl)-1-(3-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-4-(2-hydroxyethylsulfanyl)-1-(3-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110570938 |
| Molecular Formula | C19H16ClNO3S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(2-hydroxyethylsulfanyl)-1-(3-methylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1cccc(N2C(=O)C(SCCO)=C(c3ccc(Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C19H16ClNO3S/c1-12-3-2-4-15(11-12)21-18(23)16(13-5-7-14(20)8-6-13)17(19(21)24)25-10-9-22/h2-8,11,22H,9-10H2,1H3 |
| InChIKey | YZDAAVPWDHAFOA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|