C18H13Cl2NO3S — CID 110570858
1,3-bis(4-chlorophenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione (PubChem CID 110570858) has the molecular formula C18H13Cl2NO3S and a molecular weight of 394.28 g/mol. Its IUPAC name is 1,3-bis(4-chlorophenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 1,3-bis(4-chlorophenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110570858 |
| Molecular Formula | C18H13Cl2NO3S |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 1,3-bis(4-chlorophenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
| SMILES | O=C1C(SCCO)=C(c2ccc(Cl)cc2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13Cl2NO3S/c19-12-3-1-11(2-4-12)15-16(25-10-9-22)18(24)21(17(15)23)14-7-5-13(20)6-8-14/h1-8,22H,9-10H2 |
| InChIKey | TYVGVBGONIZKQQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|