C18H16N2O5S2 — CID 110561214
4-[3-(2-hydroxyethylsulfanyl)-2,5-dioxo-4-phenylpyrrol-1-yl]benzenesulfonamide (PubChem CID 110561214) has the molecular formula C18H16N2O5S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-[3-(2-hydroxyethylsulfanyl)-2,5-dioxo-4-phenylpyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-(2-hydroxyethylsulfanyl)-2,5-dioxo-4-phenylpyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 110561214 |
| Molecular Formula | C18H16N2O5S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 4-[3-(2-hydroxyethylsulfanyl)-2,5-dioxo-4-phenylpyrrol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)C(SCCO)=C(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C18H16N2O5S2/c19-27(24,25)14-8-6-13(7-9-14)20-17(22)15(12-4-2-1-3-5-12)16(18(20)23)26-11-10-21/h1-9,21H,10-11H2,(H2,19,24,25) |
| InChIKey | XSNXEHWOYKDAQV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|