C19H17FN2O4S2 — CID 110545273
4-[3-(4-fluorophenyl)-2,5-dioxo-4-propan-2-ylsulfanylpyrrol-1-yl]benzenesulfonamide (PubChem CID 110545273) has the molecular formula C19H17FN2O4S2 and a molecular weight of 420.49 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-2,5-dioxo-4-propan-2-ylsulfanylpyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-(4-fluorophenyl)-2,5-dioxo-4-propan-2-ylsulfanylpyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 110545273 |
| Molecular Formula | C19H17FN2O4S2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-2,5-dioxo-4-propan-2-ylsulfanylpyrrol-1-yl]benzenesulfonamide |
| SMILES | CC(C)SC1=C(c2ccc(F)cc2)C(=O)N(c2ccc(S(N)(=O)=O)cc2)C1=O |
| InChI | InChI=1S/C19H17FN2O4S2/c1-11(2)27-17-16(12-3-5-13(20)6-4-12)18(23)22(19(17)24)14-7-9-15(10-8-14)28(21,25)26/h3-11H,1-2H3,(H2,21,25,26) |
| InChIKey | IXUUGIPZXHPIQI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|