C23H25NO4S — CID 110575871
1-(4-methoxyphenyl)-3-(4-propan-2-yloxyphenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione (PubChem CID 110575871) has the molecular formula C23H25NO4S and a molecular weight of 411.52 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-(4-propan-2-yloxyphenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione.
| Compound Name | 1-(4-methoxyphenyl)-3-(4-propan-2-yloxyphenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110575871 |
| Molecular Formula | C23H25NO4S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-(4-propan-2-yloxyphenyl)-4-propan-2-ylsulfanylpyrrole-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C(SC(C)C)=C(c3ccc(OC(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H25NO4S/c1-14(2)28-19-10-6-16(7-11-19)20-21(29-15(3)4)23(26)24(22(20)25)17-8-12-18(27-5)13-9-17/h6-15H,1-5H3 |
| InChIKey | WRIIFBNBFMYNAD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|