C20H25NO3S — CID 110559704
1-cyclooctyl-3-(2-hydroxyethylsulfanyl)-4-phenylpyrrole-2,5-dione (PubChem CID 110559704) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is 1-cyclooctyl-3-(2-hydroxyethylsulfanyl)-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-cyclooctyl-3-(2-hydroxyethylsulfanyl)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110559704 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-cyclooctyl-3-(2-hydroxyethylsulfanyl)-4-phenylpyrrole-2,5-dione |
| SMILES | O=C1C(SCCO)=C(c2ccccc2)C(=O)N1C1CCCCCCC1 |
| InChI | InChI=1S/C20H25NO3S/c22-13-14-25-18-17(15-9-5-4-6-10-15)19(23)21(20(18)24)16-11-7-2-1-3-8-12-16/h4-6,9-10,16,22H,1-3,7-8,11-14H2 |
| InChIKey | BHXGOLOQMSSHBN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|