C20H16F3NO3S — CID 110573499
3-(2-hydroxyethylsulfanyl)-4-(4-methylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 110573499) has the molecular formula C20H16F3NO3S and a molecular weight of 407.41 g/mol. Its IUPAC name is 3-(2-hydroxyethylsulfanyl)-4-(4-methylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-(2-hydroxyethylsulfanyl)-4-(4-methylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110573499 |
| Molecular Formula | C20H16F3NO3S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 3-(2-hydroxyethylsulfanyl)-4-(4-methylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(SCCO)C(=O)N(c3cccc(C(F)(F)F)c3)C2=O)cc1 |
| InChI | InChI=1S/C20H16F3NO3S/c1-12-5-7-13(8-6-12)16-17(28-10-9-25)19(27)24(18(16)26)15-4-2-3-14(11-15)20(21,22)23/h2-8,11,25H,9-10H2,1H3 |
| InChIKey | XOAVLPJDDXEBNM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|