C23H16F3NO3S — CID 110573497
3-(furan-2-ylmethylsulfanyl)-4-(4-methylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 110573497) has the molecular formula C23H16F3NO3S and a molecular weight of 443.45 g/mol. Its IUPAC name is 3-(furan-2-ylmethylsulfanyl)-4-(4-methylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-(furan-2-ylmethylsulfanyl)-4-(4-methylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110573497 |
| Molecular Formula | C23H16F3NO3S |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 3-(furan-2-ylmethylsulfanyl)-4-(4-methylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(SCc3ccco3)C(=O)N(c3cccc(C(F)(F)F)c3)C2=O)cc1 |
| InChI | InChI=1S/C23H16F3NO3S/c1-14-7-9-15(10-8-14)19-20(31-13-18-6-3-11-30-18)22(29)27(21(19)28)17-5-2-4-16(12-17)23(24,25)26/h2-12H,13H2,1H3 |
| InChIKey | OFRYLLQNRRTEBT-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|