C22H16ClNO3S — CID 110571105
3-(4-chlorophenyl)-4-(furan-2-ylmethylsulfanyl)-1-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110571105) has the molecular formula C22H16ClNO3S and a molecular weight of 409.89 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(furan-2-ylmethylsulfanyl)-1-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-4-(furan-2-ylmethylsulfanyl)-1-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110571105 |
| Molecular Formula | C22H16ClNO3S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(furan-2-ylmethylsulfanyl)-1-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(SCc3ccco3)=C(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H16ClNO3S/c1-14-4-10-17(11-5-14)24-21(25)19(15-6-8-16(23)9-7-15)20(22(24)26)28-13-18-3-2-12-27-18/h2-12H,13H2,1H3 |
| InChIKey | WPOCFMYXWHHSDZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|