C21H18F3NO2S — CID 110549823
3-(3,4-dimethylphenyl)-4-ethylsulfanyl-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 110549823) has the molecular formula C21H18F3NO2S and a molecular weight of 405.44 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-4-ethylsulfanyl-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethylphenyl)-4-ethylsulfanyl-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110549823 |
| Molecular Formula | C21H18F3NO2S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-4-ethylsulfanyl-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | CCSC1=C(c2ccc(C)c(C)c2)C(=O)N(c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C21H18F3NO2S/c1-4-28-18-17(14-9-8-12(2)13(3)10-14)19(26)25(20(18)27)16-7-5-6-15(11-16)21(22,23)24/h5-11H,4H2,1-3H3 |
| InChIKey | JJMKWOIYQJPHIV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|