C25H25F3N2O3 — CID 110549816
3-(2,6-dimethylmorpholin-4-yl)-4-(3,4-dimethylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 110549816) has the molecular formula C25H25F3N2O3 and a molecular weight of 458.48 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-4-(3,4-dimethylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-4-(3,4-dimethylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110549816 |
| Molecular Formula | C25H25F3N2O3 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-4-(3,4-dimethylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CC(C)OC(C)C3)C(=O)N(c3cccc(C(F)(F)F)c3)C2=O)cc1C |
| InChI | InChI=1S/C25H25F3N2O3/c1-14-8-9-18(10-15(14)2)21-22(29-12-16(3)33-17(4)13-29)24(32)30(23(21)31)20-7-5-6-19(11-20)25(26,27)28/h5-11,16-17H,12-13H2,1-4H3 |
| InChIKey | KRARYWYVQDSJDI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|