C20H18FNO4S — CID 110564667
3-(3,4-dimethoxyphenyl)-4-ethylsulfanyl-1-(3-fluorophenyl)pyrrole-2,5-dione (PubChem CID 110564667) has the molecular formula C20H18FNO4S and a molecular weight of 387.43 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-ethylsulfanyl-1-(3-fluorophenyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-ethylsulfanyl-1-(3-fluorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110564667 |
| Molecular Formula | C20H18FNO4S |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-ethylsulfanyl-1-(3-fluorophenyl)pyrrole-2,5-dione |
| SMILES | CCSC1=C(c2ccc(OC)c(OC)c2)C(=O)N(c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C20H18FNO4S/c1-4-27-18-17(12-8-9-15(25-2)16(10-12)26-3)19(23)22(20(18)24)14-7-5-6-13(21)11-14/h5-11H,4H2,1-3H3 |
| InChIKey | SVLZCJGDJLECEV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|