C21H21NO6S — CID 110563806
3-(3,4-dimethoxyphenyl)-4-(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 110563806) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110563806 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-(2-hydroxyethylsulfanyl)-1-(3-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1cccc(N2C(=O)C(SCCO)=C(c3ccc(OC)c(OC)c3)C2=O)c1 |
| InChI | InChI=1S/C21H21NO6S/c1-26-15-6-4-5-14(12-15)22-20(24)18(19(21(22)25)29-10-9-23)13-7-8-16(27-2)17(11-13)28-3/h4-8,11-12,23H,9-10H2,1-3H3 |
| InChIKey | QAMSYKCFCHWIOM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|