C21H21NO4S — CID 110549933
3-(3,4-dimethylphenyl)-4-(2-hydroxyethylsulfanyl)-1-(4-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 110549933) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-4-(2-hydroxyethylsulfanyl)-1-(4-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethylphenyl)-4-(2-hydroxyethylsulfanyl)-1-(4-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110549933 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-4-(2-hydroxyethylsulfanyl)-1-(4-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C(SCCO)=C(c3ccc(C)c(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H21NO4S/c1-13-4-5-15(12-14(13)2)18-19(27-11-10-23)21(25)22(20(18)24)16-6-8-17(26-3)9-7-16/h4-9,12,23H,10-11H2,1-3H3 |
| InChIKey | WHSLRKWJKMQIEZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|