C18H11Cl2F2NO3S — CID 110568977
3-(2,4-dichlorophenyl)-1-(2,5-difluorophenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione (PubChem CID 110568977) has the molecular formula C18H11Cl2F2NO3S and a molecular weight of 430.26 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-(2,5-difluorophenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-1-(2,5-difluorophenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568977 |
| Molecular Formula | C18H11Cl2F2NO3S |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-(2,5-difluorophenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
| SMILES | O=C1C(SCCO)=C(c2ccc(Cl)cc2Cl)C(=O)N1c1cc(F)ccc1F |
| InChI | InChI=1S/C18H11Cl2F2NO3S/c19-9-1-3-11(12(20)7-9)15-16(27-6-5-24)18(26)23(17(15)25)14-8-10(21)2-4-13(14)22/h1-4,7-8,24H,5-6H2 |
| InChIKey | HQFZKMUQSIRSSF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|