C20H17F2NO3S — CID 110580543
1-(2,5-difluorophenyl)-3-(2,4-dimethylphenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione (PubChem CID 110580543) has the molecular formula C20H17F2NO3S and a molecular weight of 389.42 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-(2,4-dimethylphenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,5-difluorophenyl)-3-(2,4-dimethylphenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110580543 |
| Molecular Formula | C20H17F2NO3S |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-(2,4-dimethylphenyl)-4-(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(SCCO)C(=O)N(c3cc(F)ccc3F)C2=O)c(C)c1 |
| InChI | InChI=1S/C20H17F2NO3S/c1-11-3-5-14(12(2)9-11)17-18(27-8-7-24)20(26)23(19(17)25)16-10-13(21)4-6-15(16)22/h3-6,9-10,24H,7-8H2,1-2H3 |
| InChIKey | HCDANHCZNOTWEB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|