C21H18Cl3NO2S — CID 110568096
3-(4-chlorophenyl)sulfanyl-4-(2,4-dichlorophenyl)-1-pentylpyrrole-2,5-dione (PubChem CID 110568096) has the molecular formula C21H18Cl3NO2S and a molecular weight of 454.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-4-(2,4-dichlorophenyl)-1-pentylpyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-4-(2,4-dichlorophenyl)-1-pentylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568096 |
| Molecular Formula | C21H18Cl3NO2S |
| Molecular Weight | 454.81 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-4-(2,4-dichlorophenyl)-1-pentylpyrrole-2,5-dione |
| SMILES | CCCCCN1C(=O)C(Sc2ccc(Cl)cc2)=C(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C21H18Cl3NO2S/c1-2-3-4-11-25-20(26)18(16-10-7-14(23)12-17(16)24)19(21(25)27)28-15-8-5-13(22)6-9-15/h5-10,12H,2-4,11H2,1H3 |
| InChIKey | ZPMUEXXDSQBZJL-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.81 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|