C20H18ClNO2S — CID 110578550
3-(4-chlorophenyl)sulfanyl-4-(2,4-dimethylphenyl)-1-ethylpyrrole-2,5-dione (PubChem CID 110578550) has the molecular formula C20H18ClNO2S and a molecular weight of 371.89 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-4-(2,4-dimethylphenyl)-1-ethylpyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-4-(2,4-dimethylphenyl)-1-ethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110578550 |
| Molecular Formula | C20H18ClNO2S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-4-(2,4-dimethylphenyl)-1-ethylpyrrole-2,5-dione |
| SMILES | CCN1C(=O)C(Sc2ccc(Cl)cc2)=C(c2ccc(C)cc2C)C1=O |
| InChI | InChI=1S/C20H18ClNO2S/c1-4-22-19(23)17(16-10-5-12(2)11-13(16)3)18(20(22)24)25-15-8-6-14(21)7-9-15/h5-11H,4H2,1-3H3 |
| InChIKey | FATAEWCMXPIJQW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|