C23H31Cl2N3O2 — CID 110568478
3-(2,4-dichlorophenyl)-1-hexyl-4-[methyl-(1-methylpiperidin-4-yl)amino]pyrrole-2,5-dione (PubChem CID 110568478) has the molecular formula C23H31Cl2N3O2 and a molecular weight of 452.43 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-hexyl-4-[methyl-(1-methylpiperidin-4-yl)amino]pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-1-hexyl-4-[methyl-(1-methylpiperidin-4-yl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568478 |
| Molecular Formula | C23H31Cl2N3O2 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-hexyl-4-[methyl-(1-methylpiperidin-4-yl)amino]pyrrole-2,5-dione |
| SMILES | CCCCCCN1C(=O)C(c2ccc(Cl)cc2Cl)=C(N(C)C2CCN(C)CC2)C1=O |
| InChI | InChI=1S/C23H31Cl2N3O2/c1-4-5-6-7-12-28-22(29)20(18-9-8-16(24)15-19(18)25)21(23(28)30)27(3)17-10-13-26(2)14-11-17/h8-9,15,17H,4-7,10-14H2,1-3H3 |
| InChIKey | ZRVULSCCMLZFIQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|