C26H39N3O3 — CID 110566529
3-(2-methoxyphenyl)-4-[methyl-(1-methylpiperidin-4-yl)amino]-1-octylpyrrole-2,5-dione (PubChem CID 110566529) has the molecular formula C26H39N3O3 and a molecular weight of 441.62 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-4-[methyl-(1-methylpiperidin-4-yl)amino]-1-octylpyrrole-2,5-dione.
| Compound Name | 3-(2-methoxyphenyl)-4-[methyl-(1-methylpiperidin-4-yl)amino]-1-octylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110566529 |
| Molecular Formula | C26H39N3O3 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | 3-(2-methoxyphenyl)-4-[methyl-(1-methylpiperidin-4-yl)amino]-1-octylpyrrole-2,5-dione |
| SMILES | CCCCCCCCN1C(=O)C(c2ccccc2OC)=C(N(C)C2CCN(C)CC2)C1=O |
| InChI | InChI=1S/C26H39N3O3/c1-5-6-7-8-9-12-17-29-25(30)23(21-13-10-11-14-22(21)32-4)24(26(29)31)28(3)20-15-18-27(2)19-16-20/h10-11,13-14,20H,5-9,12,15-19H2,1-4H3 |
| InChIKey | PRQFEVFHZZTNFM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|