C19H23Cl2NO3S — CID 110568535
1-(3-butoxypropyl)-3-(2,4-dichlorophenyl)-4-ethylsulfanylpyrrole-2,5-dione (PubChem CID 110568535) has the molecular formula C19H23Cl2NO3S and a molecular weight of 416.37 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-(2,4-dichlorophenyl)-4-ethylsulfanylpyrrole-2,5-dione.
| Compound Name | 1-(3-butoxypropyl)-3-(2,4-dichlorophenyl)-4-ethylsulfanylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568535 |
| Molecular Formula | C19H23Cl2NO3S |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 1-(3-butoxypropyl)-3-(2,4-dichlorophenyl)-4-ethylsulfanylpyrrole-2,5-dione |
| SMILES | CCCCOCCCN1C(=O)C(SCC)=C(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C19H23Cl2NO3S/c1-3-5-10-25-11-6-9-22-18(23)16(17(19(22)24)26-4-2)14-8-7-13(20)12-15(14)21/h7-8,12H,3-6,9-11H2,1-2H3 |
| InChIKey | DIGIARJVVMCESM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|