C23H17Cl2NO3S — CID 110568746
3-(2,4-dichlorophenyl)-1-(4-ethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione (PubChem CID 110568746) has the molecular formula C23H17Cl2NO3S and a molecular weight of 458.37 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-(4-ethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-1-(4-ethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110568746 |
| Molecular Formula | C23H17Cl2NO3S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-(4-ethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione |
| SMILES | CCc1ccc(N2C(=O)C(SCc3ccco3)=C(c3ccc(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C23H17Cl2NO3S/c1-2-14-5-8-16(9-6-14)26-22(27)20(18-10-7-15(24)12-19(18)25)21(23(26)28)30-13-17-4-3-11-29-17/h3-12H,2,13H2,1H3 |
| InChIKey | UGWCWHFRMJSERV-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|