C26H25NO4S — CID 110567016
1-(4-butylphenyl)-3-(furan-2-ylmethylsulfanyl)-4-(2-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 110567016) has the molecular formula C26H25NO4S and a molecular weight of 447.56 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-(furan-2-ylmethylsulfanyl)-4-(2-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(4-butylphenyl)-3-(furan-2-ylmethylsulfanyl)-4-(2-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110567016 |
| Molecular Formula | C26H25NO4S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 1-(4-butylphenyl)-3-(furan-2-ylmethylsulfanyl)-4-(2-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCCCc1ccc(N2C(=O)C(SCc3ccco3)=C(c3ccccc3OC)C2=O)cc1 |
| InChI | InChI=1S/C26H25NO4S/c1-3-4-8-18-12-14-19(15-13-18)27-25(28)23(21-10-5-6-11-22(21)30-2)24(26(27)29)32-17-20-9-7-16-31-20/h5-7,9-16H,3-4,8,17H2,1-2H3 |
| InChIKey | RDGYARNDQLJRSO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|