C23H18ClNO5S — CID 110557209
1-(3-chloro-4-methoxyphenyl)-3-(furan-2-ylmethylsulfanyl)-4-(4-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 110557209) has the molecular formula C23H18ClNO5S and a molecular weight of 455.92 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-(furan-2-ylmethylsulfanyl)-4-(4-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-(furan-2-ylmethylsulfanyl)-4-(4-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110557209 |
| Molecular Formula | C23H18ClNO5S |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-(furan-2-ylmethylsulfanyl)-4-(4-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(SCc3ccco3)C(=O)N(c3ccc(OC)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C23H18ClNO5S/c1-28-16-8-5-14(6-9-16)20-21(31-13-17-4-3-11-30-17)23(27)25(22(20)26)15-7-10-19(29-2)18(24)12-15/h3-12H,13H2,1-2H3 |
| InChIKey | BLQBCOQHFBUUFC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|