C25H23NO5S — CID 110549982
1-(2,5-dimethoxyphenyl)-3-(3,4-dimethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione (PubChem CID 110549982) has the molecular formula C25H23NO5S and a molecular weight of 449.53 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-(3,4-dimethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-(3,4-dimethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110549982 |
| Molecular Formula | C25H23NO5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-(3,4-dimethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(OC)c(N2C(=O)C(SCc3ccco3)=C(c3ccc(C)c(C)c3)C2=O)c1 |
| InChI | InChI=1S/C25H23NO5S/c1-15-7-8-17(12-16(15)2)22-23(32-14-19-6-5-11-31-19)25(28)26(24(22)27)20-13-18(29-3)9-10-21(20)30-4/h5-13H,14H2,1-4H3 |
| InChIKey | FYYGKHASUIXRGN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|