C25H23NO3S — CID 110550120
1-(2,3-dimethylphenyl)-3-(3,4-dimethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione (PubChem CID 110550120) has the molecular formula C25H23NO3S and a molecular weight of 417.53 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-(3,4-dimethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,3-dimethylphenyl)-3-(3,4-dimethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110550120 |
| Molecular Formula | C25H23NO3S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-(3,4-dimethylphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(SCc3ccco3)C(=O)N(c3cccc(C)c3C)C2=O)cc1C |
| InChI | InChI=1S/C25H23NO3S/c1-15-10-11-19(13-17(15)3)22-23(30-14-20-8-6-12-29-20)25(28)26(24(22)27)21-9-5-7-16(2)18(21)4/h5-13H,14H2,1-4H3 |
| InChIKey | UEDQZIJUUYSMIZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|