C22H15F2NO4S — CID 110567796
1-(2,4-difluorophenyl)-3-(furan-2-ylmethylsulfanyl)-4-(2-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 110567796) has the molecular formula C22H15F2NO4S and a molecular weight of 427.43 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(furan-2-ylmethylsulfanyl)-4-(2-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,4-difluorophenyl)-3-(furan-2-ylmethylsulfanyl)-4-(2-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110567796 |
| Molecular Formula | C22H15F2NO4S |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(furan-2-ylmethylsulfanyl)-4-(2-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccccc1C1=C(SCc2ccco2)C(=O)N(c2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C22H15F2NO4S/c1-28-18-7-3-2-6-15(18)19-20(30-12-14-5-4-10-29-14)22(27)25(21(19)26)17-9-8-13(23)11-16(17)24/h2-11H,12H2,1H3 |
| InChIKey | HPVUIWHGFAEQLF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|