C19H19NO3S — CID 110578265
3-(2,4-dimethylphenyl)-4-ethylsulfanyl-1-(furan-2-ylmethyl)pyrrole-2,5-dione (PubChem CID 110578265) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-4-ethylsulfanyl-1-(furan-2-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dimethylphenyl)-4-ethylsulfanyl-1-(furan-2-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110578265 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-4-ethylsulfanyl-1-(furan-2-ylmethyl)pyrrole-2,5-dione |
| SMILES | CCSC1=C(c2ccc(C)cc2C)C(=O)N(Cc2ccco2)C1=O |
| InChI | InChI=1S/C19H19NO3S/c1-4-24-17-16(15-8-7-12(2)10-13(15)3)18(21)20(19(17)22)11-14-6-5-9-23-14/h5-10H,4,11H2,1-3H3 |
| InChIKey | UXXDSBDJOVGKQK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|